C19H25N3O5 — CID 3784460
1-butyl-5-[N-(2,4-dimethoxyphenyl)-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3784460) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-butyl-5-[N-(2,4-dimethoxyphenyl)-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-butyl-5-[N-(2,4-dimethoxyphenyl)-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3784460 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-butyl-5-[N-(2,4-dimethoxyphenyl)-C-ethylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c(/C(CC)=N/c2ccc(OC)cc2OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H25N3O5/c1-5-7-10-22-18(24)16(17(23)21-19(22)25)13(6-2)20-14-9-8-12(26-3)11-15(14)27-4/h8-9,11,24H,5-7,10H2,1-4H3,(H,21,23,25)/b20-13+ |
| InChIKey | TWGOJNOPRSZSEO-DEDYPNTBSA-N |
| XLogP | 2.59 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|