C7H10N6 — CID 3785566
1-[1-(1,2,4-triazol-1-yl)propyl]-1,2,4-triazole (PubChem CID 3785566) has the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. Its IUPAC name is 1-[1-(1,2,4-triazol-1-yl)propyl]-1,2,4-triazole.
| Compound Name | 1-[1-(1,2,4-triazol-1-yl)propyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 3785566 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-[1-(1,2,4-triazol-1-yl)propyl]-1,2,4-triazole |
| SMILES | CCC(n1cncn1)n1cncn1 |
| InChI | InChI=1S/C7H10N6/c1-2-7(12-5-8-3-10-12)13-6-9-4-11-13/h3-7H,2H2,1H3 |
| InChIKey | JNQVTCYNVPSPRF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |