C27H22ClN7 — CID 3786064
2-N,4-N-bis(4-anilinophenyl)-6-chloro-1,3,5-triazine-2,4-diamine (PubChem CID 3786064) has the molecular formula C27H22ClN7 and a molecular weight of 479.98 g/mol. Its IUPAC name is 2-N,4-N-bis(4-anilinophenyl)-6-chloro-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4-anilinophenyl)-6-chloro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3786064 |
| Molecular Formula | C27H22ClN7 |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-N,4-N-bis(4-anilinophenyl)-6-chloro-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1nc(Nc2ccc(Nc3ccccc3)cc2)nc(Nc2ccc(Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H22ClN7/c28-25-33-26(31-23-15-11-21(12-16-23)29-19-7-3-1-4-8-19)35-27(34-25)32-24-17-13-22(14-18-24)30-20-9-5-2-6-10-20/h1-18,29-30H,(H2,31,32,33,34,35) |
| InChIKey | BXPUOVMANHPZOK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |