C14H20Cl2O2 — CID 3786254
3,6-ditert-butyl-5,6-dichlorocyclohex-3-ene-1,2-dione (PubChem CID 3786254) has the molecular formula C14H20Cl2O2 and a molecular weight of 291.22 g/mol. Its IUPAC name is 3,6-ditert-butyl-5,6-dichlorocyclohex-3-ene-1,2-dione.
| Compound Name | 3,6-ditert-butyl-5,6-dichlorocyclohex-3-ene-1,2-dione |
|---|---|
| PubChem CID | 3786254 |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3,6-ditert-butyl-5,6-dichlorocyclohex-3-ene-1,2-dione |
| SMILES | CC(C)(C)C1=CC(Cl)C(Cl)(C(C)(C)C)C(=O)C1=O |
| InChI | InChI=1S/C14H20Cl2O2/c1-12(2,3)8-7-9(15)14(16,13(4,5)6)11(18)10(8)17/h7,9H,1-6H3 |
| InChIKey | LEUWHXYMAWMEJP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|