About 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide
2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide (PubChem CID 3786416) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide |
| PubChem CID | 3786416 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide |
| SMILES | CC1(C)c2ccccc2N(CC(N)=O)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C20H19N3O4/c1-19(2)15-5-3-4-6-16(15)22(12-18(21)24)20(19)10-9-13-11-14(23(25)26)7-8-17(13)27-20/h3-11H,12H2,1-2H3,(H2,21,24) |
| InChIKey | XABQINSAZCFVGT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide?
The IUPAC name of 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide (CID 3786416) is 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide.
What is the SMILES notation for 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide?
The canonical SMILES for 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide is CC1(C)c2ccccc2N(CC(N)=O)C12C=Cc1cc([N+](=O)[O-])ccc1O2.
What is the InChIKey of 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide?
The InChIKey is XABQINSAZCFVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4/c1-19(2)15-5-3-4-6-16(15)22(12-18(21)24)20(19)10-9-13-11-14(23(25)26)7-8-17(13)27-20/h3-11H,12H2,1-2H3,(H2,21,24).
What are the key properties of 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide?
2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide has a molecular weight of 365.39 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)acetamide is sourced from PubChem (CID 3786416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).