C31H28ClN3O4 — CID 3786422
5-[[1-[2-(2-butan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3786422) has the molecular formula C31H28ClN3O4 and a molecular weight of 542.04 g/mol. Its IUPAC name is 5-[[1-[2-(2-butan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-[2-(2-butan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3786422 |
| Molecular Formula | C31H28ClN3O4 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 5-[[1-[2-(2-butan-2-ylphenoxy)ethyl]indol-3-yl]methylidene]-1-(4-chlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC(C)c1ccccc1OCCn1cc(C=C2C(=O)NC(=O)N(c3ccc(Cl)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C31H28ClN3O4/c1-3-20(2)24-8-5-7-11-28(24)39-17-16-34-19-21(25-9-4-6-10-27(25)34)18-26-29(36)33-31(38)35(30(26)37)23-14-12-22(32)13-15-23/h4-15,18-20H,3,16-17H2,1-2H3,(H,33,36,38) |
| InChIKey | FDCOGTJMLIRZNA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|