C14H20FN3O6 — CID 3786859
2-(4-fluoroanilino)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide (PubChem CID 3786859) has the molecular formula C14H20FN3O6 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide.
| Compound Name | 2-(4-fluoroanilino)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide |
|---|---|
| PubChem CID | 3786859 |
| Molecular Formula | C14H20FN3O6 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(4-fluoroanilino)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide |
| SMILES | O=C(CNc1ccc(F)cc1)NN=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H20FN3O6/c15-8-1-3-9(4-2-8)16-6-12(22)18-17-5-10(20)13(23)14(24)11(21)7-19/h1-5,10-11,13-14,16,19-21,23-24H,6-7H2,(H,18,22) |
| InChIKey | VAVKCVWEUFKQQW-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|