About 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide
2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide (PubChem CID 3787050) has the molecular formula C13H13N3O4
and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 3787050 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)Nc2ccc3c(c2)OCO3)co1 |
| InChI | InChI=1S/C13H13N3O4/c1-7(14)13-16-9(5-18-13)12(17)15-8-2-3-10-11(4-8)20-6-19-10/h2-5,7H,6,14H2,1H3,(H,15,17) |
| InChIKey | RGUMMDVKELVAKP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide (CID 3787050) is 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide is CC(N)c1nc(C(=O)Nc2ccc3c(c2)OCO3)co1.
What is the InChIKey of 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
The InChIKey is RGUMMDVKELVAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4/c1-7(14)13-16-9(5-18-13)12(17)15-8-2-3-10-11(4-8)20-6-19-10/h2-5,7H,6,14H2,1H3,(H,15,17).
What are the key properties of 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide?
2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide has a molecular weight of 275.26 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminoethyl)-N-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 3787050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).