C32H24N6O2 — CID 3788039
N-(1,3-benzodioxol-5-yl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine (PubChem CID 3788039) has the molecular formula C32H24N6O2 and a molecular weight of 524.58 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
|---|---|
| PubChem CID | 3788039 |
| Molecular Formula | C32H24N6O2 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1)N1C(=N2)C(Nc2ccc3c(c2)OCO3)=Nc2ccccc21 |
| InChI | InChI=1S/C32H24N6O2/c1-20-28-29(21-10-4-2-5-11-21)37-25-15-9-8-14-24(25)34-30(33-22-16-17-26-27(18-22)40-19-39-26)32(37)35-31(28)38(36-20)23-12-6-3-7-13-23/h2-18,29H,19H2,1H3,(H,33,34) |
| InChIKey | AIXYPXYZFZUEDL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |