About 2-cyano-N-(3,4-dimethoxyphenyl)acetamide
2-cyano-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 3788216) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-cyano-N-(3,4-dimethoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-(3,4-dimethoxyphenyl)acetamide |
| PubChem CID | 3788216 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-cyano-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC#N)cc1OC |
| InChI | InChI=1S/C11H12N2O3/c1-15-9-4-3-8(7-10(9)16-2)13-11(14)5-6-12/h3-4,7H,5H2,1-2H3,(H,13,14) |
| InChIKey | FQSFOQOBZIALFQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyano-N-(3,4-dimethoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(3,4-dimethoxyphenyl)acetamide?
The IUPAC name of 2-cyano-N-(3,4-dimethoxyphenyl)acetamide (CID 3788216) is 2-cyano-N-(3,4-dimethoxyphenyl)acetamide.
What is the SMILES notation for 2-cyano-N-(3,4-dimethoxyphenyl)acetamide?
The canonical SMILES for 2-cyano-N-(3,4-dimethoxyphenyl)acetamide is COc1ccc(NC(=O)CC#N)cc1OC.
What is the InChIKey of 2-cyano-N-(3,4-dimethoxyphenyl)acetamide?
The InChIKey is FQSFOQOBZIALFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-15-9-4-3-8(7-10(9)16-2)13-11(14)5-6-12/h3-4,7H,5H2,1-2H3,(H,13,14).
What are the key properties of 2-cyano-N-(3,4-dimethoxyphenyl)acetamide?
2-cyano-N-(3,4-dimethoxyphenyl)acetamide has a molecular weight of 220.23 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(3,4-dimethoxyphenyl)acetamide is sourced from PubChem (CID 3788216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).