C11H17N3O3S — CID 3788382
N-(3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)-2-methylsulfanylacetamide (PubChem CID 3788382) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-(3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)-2-methylsulfanylacetamide.
| Compound Name | N-(3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 3788382 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NC1CCN2C(=O)C(C)NC(=O)C12 |
| InChI | InChI=1S/C11H17N3O3S/c1-6-11(17)14-4-3-7(9(14)10(16)12-6)13-8(15)5-18-2/h6-7,9H,3-5H2,1-2H3,(H,12,16)(H,13,15) |
| InChIKey | JVYKVPSGSGONKR-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |