C24H19N3O6 — CID 3788587
5-(3-methoxyphenyl)-3-(2-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3788587) has the molecular formula C24H19N3O6 and a molecular weight of 445.43 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-3-(2-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(3-methoxyphenyl)-3-(2-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3788587 |
| Molecular Formula | C24H19N3O6 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-(3-methoxyphenyl)-3-(2-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1cccc(N2C(=O)C3ON(c4ccccc4)C(c4ccccc4[N+](=O)[O-])C3C2=O)c1 |
| InChI | InChI=1S/C24H19N3O6/c1-32-17-11-7-10-16(14-17)25-23(28)20-21(18-12-5-6-13-19(18)27(30)31)26(33-22(20)24(25)29)15-8-3-2-4-9-15/h2-14,20-22H,1H3 |
| InChIKey | OZVWQMZSXNUHBB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|