C6Cl2O4-2 — CID 3788808
2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate (PubChem CID 3788808) has the molecular formula C6Cl2O4-2 and a molecular weight of 206.97 g/mol. Its IUPAC name is 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate.
| Compound Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate |
|---|---|
| PubChem CID | 3788808 |
| Molecular Formula | C6Cl2O4-2 |
| Molecular Weight | 206.97 g/mol |
| Exact Mass | 205.92 |
| IUPAC Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate |
| SMILES | O=C1C([O-])=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/C6H2Cl2O4/c7-1-3(9)5(11)2(8)6(12)4(1)10/h9,12H/p-2 |
| InChIKey | IPPWILKGXFOXHO-UHFFFAOYSA-L |
| XLogP | -1.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.97 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|