C29H31ClN2O2 — CID 3789077
9-chloro-5-(4-hexoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 3789077) has the molecular formula C29H31ClN2O2 and a molecular weight of 475.03 g/mol. Its IUPAC name is 9-chloro-5-(4-hexoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | 9-chloro-5-(4-hexoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 3789077 |
| Molecular Formula | C29H31ClN2O2 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 9-chloro-5-(4-hexoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CCCCCCOc1ccc(C2Oc3ccc(Cl)cc3C3CC(c4ccc(C)cc4)=NN32)cc1 |
| InChI | InChI=1S/C29H31ClN2O2/c1-3-4-5-6-17-33-24-14-11-22(12-15-24)29-32-27(25-18-23(30)13-16-28(25)34-29)19-26(31-32)21-9-7-20(2)8-10-21/h7-16,18,27,29H,3-6,17,19H2,1-2H3 |
| InChIKey | IPJCHLHPQMFQBX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|