C22H24BrN3O5 — CID 3789259
6-[3-[5-(4-bromophenyl)furan-2-yl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]hexanamide (PubChem CID 3789259) has the molecular formula C22H24BrN3O5 and a molecular weight of 490.35 g/mol. Its IUPAC name is 6-[3-[5-(4-bromophenyl)furan-2-yl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]hexanamide.
| Compound Name | 6-[3-[5-(4-bromophenyl)furan-2-yl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 3789259 |
| Molecular Formula | C22H24BrN3O5 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 6-[3-[5-(4-bromophenyl)furan-2-yl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]hexanamide |
| SMILES | CN1C(=O)C2ON(CCCCCC(N)=O)C(c3ccc(-c4ccc(Br)cc4)o3)C2C1=O |
| InChI | InChI=1S/C22H24BrN3O5/c1-25-21(28)18-19(16-11-10-15(30-16)13-6-8-14(23)9-7-13)26(31-20(18)22(25)29)12-4-2-3-5-17(24)27/h6-11,18-20H,2-5,12H2,1H3,(H2,24,27) |
| InChIKey | UMQWMBVZRNFYGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|