C15H14Cl2N8O3 — CID 3789479
N-(4,6-dichloropyrimidin-5-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 3789479) has the molecular formula C15H14Cl2N8O3 and a molecular weight of 425.24 g/mol. Its IUPAC name is N-(4,6-dichloropyrimidin-5-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-(4,6-dichloropyrimidin-5-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3789479 |
| Molecular Formula | C15H14Cl2N8O3 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-(4,6-dichloropyrimidin-5-yl)-5-(4-methylpiperazin-1-yl)-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CN1CCN(c2cc(Nc3c(Cl)ncnc3Cl)c3nonc3c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H14Cl2N8O3/c1-23-2-4-24(5-3-23)9-6-8(20-12-14(16)18-7-19-15(12)17)10-11(22-28-21-10)13(9)25(26)27/h6-7,20H,2-5H2,1H3 |
| InChIKey | WMEVKWXTZLXIOF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|