About methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate
methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 3789519) has the molecular formula C10H8FN3O2
and a molecular weight of 221.19 g/mol. Its IUPAC name is methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate.
Molecular Properties
| Compound Name | methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate |
| PubChem CID | 3789519 |
| Molecular Formula | C10H8FN3O2 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C10H8FN3O2/c1-16-10(15)7-2-3-9(8(11)4-7)14-6-12-5-13-14/h2-6H,1H3 |
| InChIKey | KXDQCVZGWJKRMH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate?
The IUPAC name of methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate (CID 3789519) is methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate.
What is the SMILES notation for methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate?
The canonical SMILES for methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate is COC(=O)c1ccc(-n2cncn2)c(F)c1.
What is the InChIKey of methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate?
The InChIKey is KXDQCVZGWJKRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN3O2/c1-16-10(15)7-2-3-9(8(11)4-7)14-6-12-5-13-14/h2-6H,1H3.
What are the key properties of methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate?
methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate has a molecular weight of 221.19 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-fluoro-4-(1,2,4-triazol-1-yl)benzoate is sourced from PubChem (CID 3789519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).