About N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide
N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide (PubChem CID 3789525) has the molecular formula C22H23F3N6O
and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide.
Molecular Properties
| Compound Name | N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide |
| PubChem CID | 3789525 |
| Molecular Formula | C22H23F3N6O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide |
| SMILES | Cc1cccc(C)c1-n1nnnc1C1(N(N=O)c2cccc(C(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C22H23F3N6O/c1-15-8-6-9-16(2)19(15)30-20(26-27-28-30)21(12-4-3-5-13-21)31(29-32)18-11-7-10-17(14-18)22(23,24)25/h6-11,14H,3-5,12-13H2,1-2H3 |
| InChIKey | XRFHDNKHQQVODS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide?
The IUPAC name of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide (CID 3789525) is N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide.
What is the SMILES notation for N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide?
The canonical SMILES for N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide is Cc1cccc(C)c1-n1nnnc1C1(N(N=O)c2cccc(C(F)(F)F)c2)CCCCC1.
What is the InChIKey of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide?
The InChIKey is XRFHDNKHQQVODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F3N6O/c1-15-8-6-9-16(2)19(15)30-20(26-27-28-30)21(12-4-3-5-13-21)31(29-32)18-11-7-10-17(14-18)22(23,24)25/h6-11,14H,3-5,12-13H2,1-2H3.
What are the key properties of N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide?
N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide has a molecular weight of 444.46 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-N-[3-(trifluoromethyl)phenyl]nitrous amide is sourced from PubChem (CID 3789525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).