C18H20N2O2S — CID 3789673
2-(3-ethoxyphenyl)-3-(2-pyridin-3-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 3789673) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-(3-ethoxyphenyl)-3-(2-pyridin-3-ylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-ethoxyphenyl)-3-(2-pyridin-3-ylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3789673 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(3-ethoxyphenyl)-3-(2-pyridin-3-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1cccc(C2SCC(=O)N2CCc2cccnc2)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-2-22-16-7-3-6-15(11-16)18-20(17(21)13-23-18)10-8-14-5-4-9-19-12-14/h3-7,9,11-12,18H,2,8,10,13H2,1H3 |
| InChIKey | FHEUDPFLXFRESG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |