About 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol
3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol (PubChem CID 3790624) has the molecular formula C22H25NO
and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol |
| PubChem CID | 3790624 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol |
| SMILES | CC1CCN(C)CC1C#CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO/c1-18-14-16-23(2)17-19(18)13-15-22(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,18-19,24H,14,16-17H2,1-2H3 |
| InChIKey | BFXRASMNEAQTBE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol?
The IUPAC name of 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol (CID 3790624) is 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol.
What is the SMILES notation for 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol?
The canonical SMILES for 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol is CC1CCN(C)CC1C#CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol?
The InChIKey is BFXRASMNEAQTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO/c1-18-14-16-23(2)17-19(18)13-15-22(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,18-19,24H,14,16-17H2,1-2H3.
What are the key properties of 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol?
3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol has a molecular weight of 319.45 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dimethylpiperidin-3-yl)-1,1-diphenylprop-2-yn-1-ol is sourced from PubChem (CID 3790624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).