C17H21N3O2 — CID 3791031
N'-acetyl-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanehydrazide (PubChem CID 3791031) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N'-acetyl-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanehydrazide.
| Compound Name | N'-acetyl-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanehydrazide |
|---|---|
| PubChem CID | 3791031 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N'-acetyl-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propanehydrazide |
| SMILES | CC(=O)NNC(=O)CCn1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C17H21N3O2/c1-12(21)18-19-17(22)10-11-20-15-8-4-2-6-13(15)14-7-3-5-9-16(14)20/h2,4,6,8H,3,5,7,9-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | VNEAHZDYPVYBEY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|