C24H23ClF3N5OS — CID 3791139
2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 3791139) has the molecular formula C24H23ClF3N5OS and a molecular weight of 522.00 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3791139 |
| Molecular Formula | C24H23ClF3N5OS |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1C1CCCCC1)NN=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23ClF3N5OS/c25-19-12-8-17(9-13-19)22-31-32-23(33(22)20-4-2-1-3-5-20)35-15-21(34)30-29-14-16-6-10-18(11-7-16)24(26,27)28/h6-14,20H,1-5,15H2,(H,30,34) |
| InChIKey | AZOYDNLRRWGNCO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|