About 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine
5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine (PubChem CID 3791908) has the molecular formula C11H14ClNO
and a molecular weight of 211.69 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine |
| PubChem CID | 3791908 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine |
| SMILES | Cc1ccc(C2NCC(CCl)O2)cc1 |
| InChI | InChI=1S/C11H14ClNO/c1-8-2-4-9(5-3-8)11-13-7-10(6-12)14-11/h2-5,10-11,13H,6-7H2,1H3 |
| InChIKey | ADZPAMCMIRQXAV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine?
The IUPAC name of 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine (CID 3791908) is 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine.
What is the SMILES notation for 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine?
The canonical SMILES for 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine is Cc1ccc(C2NCC(CCl)O2)cc1.
What is the InChIKey of 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine?
The InChIKey is ADZPAMCMIRQXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO/c1-8-2-4-9(5-3-8)11-13-7-10(6-12)14-11/h2-5,10-11,13H,6-7H2,1H3.
What are the key properties of 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine?
5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine has a molecular weight of 211.69 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-2-(4-methylphenyl)-1,3-oxazolidine is sourced from PubChem (CID 3791908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).