About o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)-
o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- (PubChem CID 379214) has the molecular formula C12H20ClN3
and a molecular weight of 241.76 g/mol. Its IUPAC name is 4-chloro-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- |
| PubChem CID | 379214 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-chloro-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine |
| SMILES | CCN(CC)CCNC1=C(C=C(C=C1)Cl)N |
| InChI | InChI=1S/C12H20ClN3/c1-3-16(4-2)8-7-15-12-6-5-10(13)9-11(12)14/h5-6,9,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | MYPGRCWCDOXEOB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | 185 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)-?
The IUPAC name of o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- (CID 379214) is 4-chloro-1-N-[2-(diethylamino)ethyl]benzene-1,2-diamine.
What is the SMILES notation for o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)-?
The canonical SMILES for o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- is CCN(CC)CCNC1=C(C=C(C=C1)Cl)N.
What is the InChIKey of o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)-?
The InChIKey is MYPGRCWCDOXEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3/c1-3-16(4-2)8-7-15-12-6-5-10(13)9-11(12)14/h5-6,9,15H,3-4,7-8,14H2,1-2H3.
What are the key properties of o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)-?
o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- has a molecular weight of 241.76 g/mol, XLogP of 2.60, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for o-Phenylenediamine, 4-chloro-N-(2-(diethylamino)ethyl)- is sourced from PubChem (CID 379214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).