About 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide
1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide (PubChem CID 3792524) has the molecular formula C16H22FN3O3
and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide |
| PubChem CID | 3792524 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)C1CCCN(C(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H22FN3O3/c1-23-10-8-18-15(21)12-3-2-9-20(11-12)16(22)19-14-6-4-13(17)5-7-14/h4-7,12H,2-3,8-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | QSTUEJJTUBHEME-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide?
The IUPAC name of 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide (CID 3792524) is 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide.
What is the SMILES notation for 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide?
The canonical SMILES for 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide is COCCNC(=O)C1CCCN(C(=O)Nc2ccc(F)cc2)C1.
What is the InChIKey of 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide?
The InChIKey is QSTUEJJTUBHEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FN3O3/c1-23-10-8-18-15(21)12-3-2-9-20(11-12)16(22)19-14-6-4-13(17)5-7-14/h4-7,12H,2-3,8-11H2,1H3,(H,18,21)(H,19,22).
What are the key properties of 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide?
1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide has a molecular weight of 323.37 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(4-fluorophenyl)-3-N-(2-methoxyethyl)piperidine-1,3-dicarboxamide is sourced from PubChem (CID 3792524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).