About N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide
N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide (PubChem CID 3792618) has the molecular formula C15H16ClN3
and a molecular weight of 273.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide |
| PubChem CID | 3792618 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide |
| SMILES | CC(C)/N=C(/Nc1ccc(Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C15H16ClN3/c1-11(2)18-15(12-4-3-9-17-10-12)19-14-7-5-13(16)6-8-14/h3-11H,1-2H3,(H,18,19) |
| InChIKey | NPBJOTYNAIDZFU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide?
The IUPAC name of N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide (CID 3792618) is N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide.
What is the SMILES notation for N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide?
The canonical SMILES for N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide is CC(C)/N=C(/Nc1ccc(Cl)cc1)c1cccnc1.
What is the InChIKey of N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide?
The InChIKey is NPBJOTYNAIDZFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3/c1-11(2)18-15(12-4-3-9-17-10-12)19-14-7-5-13(16)6-8-14/h3-11H,1-2H3,(H,18,19).
What are the key properties of N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide?
N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide has a molecular weight of 273.77 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-N'-propan-2-ylpyridine-3-carboximidamide is sourced from PubChem (CID 3792618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).