C20H15ClN2O4S — CID 3792980
N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)-1,3-oxazol-5-amine (PubChem CID 3792980) has the molecular formula C20H15ClN2O4S and a molecular weight of 414.87 g/mol. Its IUPAC name is N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)-1,3-oxazol-5-amine.
| Compound Name | N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 3792980 |
| Molecular Formula | C20H15ClN2O4S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-benzyl-4-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)-1,3-oxazol-5-amine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1nc(-c2ccco2)oc1NCc1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O4S/c21-15-8-10-16(11-9-15)28(24,25)20-19(22-13-14-5-2-1-3-6-14)27-18(23-20)17-7-4-12-26-17/h1-12,22H,13H2 |
| InChIKey | UHBHPVOUSZECBD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |