C26H22N4O5 — CID 3793116
1,5-bis(2-methoxyphenyl)-4,6-dioxo-N-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxamide (PubChem CID 3793116) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is 1,5-bis(2-methoxyphenyl)-4,6-dioxo-N-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxamide.
| Compound Name | 1,5-bis(2-methoxyphenyl)-4,6-dioxo-N-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 3793116 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 1,5-bis(2-methoxyphenyl)-4,6-dioxo-N-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxamide |
| SMILES | COc1ccccc1N1C(=O)C2C(C(=O)Nc3ccccc3)=NN(c3ccccc3OC)C2C1=O |
| InChI | InChI=1S/C26H22N4O5/c1-34-19-14-8-6-12-17(19)29-25(32)21-22(24(31)27-16-10-4-3-5-11-16)28-30(23(21)26(29)33)18-13-7-9-15-20(18)35-2/h3-15,21,23H,1-2H3,(H,27,31) |
| InChIKey | MMGRKZZHYXNAEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|