About 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea
1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea (PubChem CID 3793280) has the molecular formula C19H11F9N4O
and a molecular weight of 482.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea |
| PubChem CID | 3793280 |
| Molecular Formula | C19H11F9N4O |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H11F9N4O/c20-17(21,22)10-6-11(18(23,24)25)8-12(7-10)30-16(33)31-14-9-29-32(15(14)19(26,27)28)13-4-2-1-3-5-13/h1-9H,(H2,30,31,33) |
| InChIKey | BIAROGICWOPRFR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea (CID 3793280) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea is O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cnn(-c2ccccc2)c1C(F)(F)F.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea?
The InChIKey is BIAROGICWOPRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F9N4O/c20-17(21,22)10-6-11(18(23,24)25)8-12(7-10)30-16(33)31-14-9-29-32(15(14)19(26,27)28)13-4-2-1-3-5-13/h1-9H,(H2,30,31,33).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea?
1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea has a molecular weight of 482.31 g/mol, XLogP of 6.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-phenyl-5-(trifluoromethyl)pyrazol-4-yl]urea is sourced from PubChem (CID 3793280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).