About 6-amino-2,4-dimethylpyridine-3-carbonitrile
6-amino-2,4-dimethylpyridine-3-carbonitrile (PubChem CID 3793299) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 6-amino-2,4-dimethylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-2,4-dimethylpyridine-3-carbonitrile |
| PubChem CID | 3793299 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 6-amino-2,4-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(N)nc(C)c1C#N |
| InChI | InChI=1S/C8H9N3/c1-5-3-8(10)11-6(2)7(5)4-9/h3H,1-2H3,(H2,10,11) |
| InChIKey | ZFXMWBGQRGABCI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-2,4-dimethylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,4-dimethylpyridine-3-carbonitrile?
The IUPAC name of 6-amino-2,4-dimethylpyridine-3-carbonitrile (CID 3793299) is 6-amino-2,4-dimethylpyridine-3-carbonitrile.
What is the SMILES notation for 6-amino-2,4-dimethylpyridine-3-carbonitrile?
The canonical SMILES for 6-amino-2,4-dimethylpyridine-3-carbonitrile is Cc1cc(N)nc(C)c1C#N.
What is the InChIKey of 6-amino-2,4-dimethylpyridine-3-carbonitrile?
The InChIKey is ZFXMWBGQRGABCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-5-3-8(10)11-6(2)7(5)4-9/h3H,1-2H3,(H2,10,11).
What are the key properties of 6-amino-2,4-dimethylpyridine-3-carbonitrile?
6-amino-2,4-dimethylpyridine-3-carbonitrile has a molecular weight of 147.18 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,4-dimethylpyridine-3-carbonitrile is sourced from PubChem (CID 3793299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).