C11H10Cl2IN3O — CID 3793490
5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine (PubChem CID 3793490) has the molecular formula C11H10Cl2IN3O and a molecular weight of 398.03 g/mol. Its IUPAC name is 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine.
| Compound Name | 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 3793490 |
| Molecular Formula | C11H10Cl2IN3O |
| Molecular Weight | 398.03 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
| SMILES | CCOc1c(Cl)cc(Cl)cc1-c1[nH]nc(N)c1I |
| InChI | InChI=1S/C11H10Cl2IN3O/c1-2-18-10-6(3-5(12)4-7(10)13)9-8(14)11(15)17-16-9/h3-4H,2H2,1H3,(H3,15,16,17) |
| InChIKey | YNLBSBSISWNUMW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|