About 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine
5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine (PubChem CID 3793490) has the molecular formula C11H10Cl2IN3O
and a molecular weight of 398.03 g/mol. Its IUPAC name is 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
| PubChem CID | 3793490 |
| Molecular Formula | C11H10Cl2IN3O |
| Molecular Weight | 398.03 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
| SMILES | CCOc1c(Cl)cc(Cl)cc1-c1[nH]nc(N)c1I |
| InChI | InChI=1S/C11H10Cl2IN3O/c1-2-18-10-6(3-5(12)4-7(10)13)9-8(14)11(15)17-16-9/h3-4H,2H2,1H3,(H3,15,16,17) |
| InChIKey | YNLBSBSISWNUMW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
The IUPAC name of 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine (CID 3793490) is 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
The canonical SMILES for 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine is CCOc1c(Cl)cc(Cl)cc1-c1[nH]nc(N)c1I.
What is the InChIKey of 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
The InChIKey is YNLBSBSISWNUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2IN3O/c1-2-18-10-6(3-5(12)4-7(10)13)9-8(14)11(15)17-16-9/h3-4H,2H2,1H3,(H3,15,16,17).
What are the key properties of 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine has a molecular weight of 398.03 g/mol, XLogP of 3.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichloro-2-ethoxyphenyl)-4-iodo-1H-pyrazol-3-amine is sourced from PubChem (CID 3793490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).