About 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one
7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (PubChem CID 3794202) has the molecular formula C15H25N2O+
and a molecular weight of 249.38 g/mol. Its IUPAC name is 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one.
Molecular Properties
| Compound Name | 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| PubChem CID | 3794202 |
| Molecular Formula | C15H25N2O+ |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES | O=C1CCCC2C3CC(CN12)C1CCCC[NH+]1C3 |
| InChI | InChI=1S/C15H24N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-14H,1-10H2/p+1 |
| InChIKey | JYIJIIVLEOETIQ-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one?
The IUPAC name of 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (CID 3794202) is 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one.
What is the SMILES notation for 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one?
The canonical SMILES for 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one is O=C1CCCC2C3CC(CN12)C1CCCC[NH+]1C3.
What is the InChIKey of 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one?
The InChIKey is JYIJIIVLEOETIQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H24N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-14H,1-10H2/p+1.
What are the key properties of 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one?
7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one has a molecular weight of 249.38 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one is sourced from PubChem (CID 3794202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).