About sodium 2-formylbenzenesulfonate
sodium 2-formylbenzenesulfonate (PubChem CID 3794540) has the molecular formula C7H5NaO4S
and a molecular weight of 208.17 g/mol. Its IUPAC name is sodium 2-formylbenzenesulfonate.
Molecular Properties
| Compound Name | sodium 2-formylbenzenesulfonate |
| PubChem CID | 3794540 |
| Molecular Formula | C7H5NaO4S |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | sodium 2-formylbenzenesulfonate |
| SMILES | O=Cc1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H6O4S.Na/c8-5-6-3-1-2-4-7(6)12(9,10)11;/h1-5H,(H,9,10,11);/q;+1/p-1 |
| InChIKey | ADPUQRRLAAPXGT-UHFFFAOYSA-M |
| XLogP | -2.59 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-formylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-formylbenzenesulfonate?
The IUPAC name of sodium 2-formylbenzenesulfonate (CID 3794540) is sodium 2-formylbenzenesulfonate.
What is the SMILES notation for sodium 2-formylbenzenesulfonate?
The canonical SMILES for sodium 2-formylbenzenesulfonate is O=Cc1ccccc1S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 2-formylbenzenesulfonate?
The InChIKey is ADPUQRRLAAPXGT-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O4S.Na/c8-5-6-3-1-2-4-7(6)12(9,10)11;/h1-5H,(H,9,10,11);/q;+1/p-1.
What are the key properties of sodium 2-formylbenzenesulfonate?
sodium 2-formylbenzenesulfonate has a molecular weight of 208.17 g/mol, XLogP of -2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-formylbenzenesulfonate is sourced from PubChem (CID 3794540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).