C19H20FN5 — CID 3794549
7-(4-ethylphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 3794549) has the molecular formula C19H20FN5 and a molecular weight of 337.40 g/mol. Its IUPAC name is 7-(4-ethylphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-(4-ethylphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 3794549 |
| Molecular Formula | C19H20FN5 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 7-(4-ethylphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CCc1ccc(C2CC(c3ccc(F)cc3)Nc3nc(N)nn32)cc1 |
| InChI | InChI=1S/C19H20FN5/c1-2-12-3-5-14(6-4-12)17-11-16(13-7-9-15(20)10-8-13)22-19-23-18(21)24-25(17)19/h3-10,16-17H,2,11H2,1H3,(H3,21,22,23,24) |
| InChIKey | QNTXKYZDYHUOTN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |