About 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one
3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one (PubChem CID 3795436) has the molecular formula C21H25NO
and a molecular weight of 307.44 g/mol. Its IUPAC name is 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one |
| PubChem CID | 3795436 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one |
| SMILES | Cc1ccccc1C1NC(c2ccccc2C)C(C)C(=O)C1C |
| InChI | InChI=1S/C21H25NO/c1-13-9-5-7-11-17(13)19-15(3)21(23)16(4)20(22-19)18-12-8-6-10-14(18)2/h5-12,15-16,19-20,22H,1-4H3 |
| InChIKey | GZFSBHPTKSDFKX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one?
The IUPAC name of 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one (CID 3795436) is 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one.
What is the SMILES notation for 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one?
The canonical SMILES for 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one is Cc1ccccc1C1NC(c2ccccc2C)C(C)C(=O)C1C.
What is the InChIKey of 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one?
The InChIKey is GZFSBHPTKSDFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO/c1-13-9-5-7-11-17(13)19-15(3)21(23)16(4)20(22-19)18-12-8-6-10-14(18)2/h5-12,15-16,19-20,22H,1-4H3.
What are the key properties of 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one?
3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one has a molecular weight of 307.44 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2,6-bis(2-methylphenyl)piperidin-4-one is sourced from PubChem (CID 3795436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).