About 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione
1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione (PubChem CID 3797035) has the molecular formula C16H12Cl2N2O3
and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione |
| PubChem CID | 3797035 |
| Molecular Formula | C16H12Cl2N2O3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N(O)c2ccccc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O3/c17-12-7-6-11(8-13(12)18)19-15(21)9-14(16(19)22)20(23)10-4-2-1-3-5-10/h1-8,14,23H,9H2 |
| InChIKey | POGWPEBLHVDLIE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione?
The IUPAC name of 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione (CID 3797035) is 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione?
The canonical SMILES for 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione is O=C1CC(N(O)c2ccccc2)C(=O)N1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione?
The InChIKey is POGWPEBLHVDLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N2O3/c17-12-7-6-11(8-13(12)18)19-15(21)9-14(16(19)22)20(23)10-4-2-1-3-5-10/h1-8,14,23H,9H2.
What are the key properties of 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione?
1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione has a molecular weight of 351.19 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-3-(N-hydroxyanilino)pyrrolidine-2,5-dione is sourced from PubChem (CID 3797035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).