About 2-hexylbenzotriazole
2-hexylbenzotriazole (PubChem CID 3797398) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-hexylbenzotriazole.
Molecular Properties
| Compound Name | 2-hexylbenzotriazole |
| PubChem CID | 3797398 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-hexylbenzotriazole |
| SMILES | CCCCCCn1nc2ccccc2n1 |
| InChI | InChI=1S/C12H17N3/c1-2-3-4-7-10-15-13-11-8-5-6-9-12(11)14-15/h5-6,8-9H,2-4,7,10H2,1H3 |
| InChIKey | NJIGIMNMVICQGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylbenzotriazole?
The IUPAC name of 2-hexylbenzotriazole (CID 3797398) is 2-hexylbenzotriazole.
What is the SMILES notation for 2-hexylbenzotriazole?
The canonical SMILES for 2-hexylbenzotriazole is CCCCCCn1nc2ccccc2n1.
What is the InChIKey of 2-hexylbenzotriazole?
The InChIKey is NJIGIMNMVICQGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-2-3-4-7-10-15-13-11-8-5-6-9-12(11)14-15/h5-6,8-9H,2-4,7,10H2,1H3.
What are the key properties of 2-hexylbenzotriazole?
2-hexylbenzotriazole has a molecular weight of 203.29 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylbenzotriazole is sourced from PubChem (CID 3797398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).