C23H28N4O4 — CID 3797605
ethyl 4-[[4-[2-(N-methylanilino)-2-oxoethyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 3797605) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 4-[[4-[2-(N-methylanilino)-2-oxoethyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[2-(N-methylanilino)-2-oxoethyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3797605 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | ethyl 4-[[4-[2-(N-methylanilino)-2-oxoethyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCN(CC(=O)N(C)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-3-31-22(29)18-9-11-19(12-10-18)24-23(30)27-15-13-26(14-16-27)17-21(28)25(2)20-7-5-4-6-8-20/h4-12H,3,13-17H2,1-2H3,(H,24,30) |
| InChIKey | BINIIVPHUVWLOC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |