C31H25F2NO3 — CID 3797774
1-(2,2-dimethylpropanoyl)-7-fluoro-2-(4-fluorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 3797774) has the molecular formula C31H25F2NO3 and a molecular weight of 497.54 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-7-fluoro-2-(4-fluorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 1-(2,2-dimethylpropanoyl)-7-fluoro-2-(4-fluorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 3797774 |
| Molecular Formula | C31H25F2NO3 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-7-fluoro-2-(4-fluorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | CC(C)(C)C(=O)C1C(c2ccc(F)cc2)C2(C(=O)c3ccccc3C2=O)C2C=Cc3cc(F)ccc3N12 |
| InChI | InChI=1S/C31H25F2NO3/c1-30(2,3)29(37)26-25(17-8-11-19(32)12-9-17)31(27(35)21-6-4-5-7-22(21)28(31)36)24-15-10-18-16-20(33)13-14-23(18)34(24)26/h4-16,24-26H,1-3H3 |
| InChIKey | ZSSSEMZRTYSCSG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|