About N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide
N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide (PubChem CID 3797849) has the molecular formula C28H25N3O
and a molecular weight of 419.53 g/mol. Its IUPAC name is N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide.
Molecular Properties
| Compound Name | N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide |
| PubChem CID | 3797849 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1c(C#N)c(-c2ccccc2)c(-c2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C28H25N3O/c1-2-12-25(32)30-28-24(19-29)26(22-15-8-4-9-16-22)27(23-17-10-5-11-18-23)31(28)20-21-13-6-3-7-14-21/h3-11,13-18H,2,12,20H2,1H3,(H,30,32) |
| InChIKey | FSZSTVHJZVQDLZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide?
The IUPAC name of N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide (CID 3797849) is N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide.
What is the SMILES notation for N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide?
The canonical SMILES for N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide is CCCC(=O)Nc1c(C#N)c(-c2ccccc2)c(-c2ccccc2)n1Cc1ccccc1.
What is the InChIKey of N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide?
The InChIKey is FSZSTVHJZVQDLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25N3O/c1-2-12-25(32)30-28-24(19-29)26(22-15-8-4-9-16-22)27(23-17-10-5-11-18-23)31(28)20-21-13-6-3-7-14-21/h3-11,13-18H,2,12,20H2,1H3,(H,30,32).
What are the key properties of N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide?
N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide has a molecular weight of 419.53 g/mol, XLogP of 6.48, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzyl-3-cyano-4,5-diphenylpyrrol-2-yl)butanamide is sourced from PubChem (CID 3797849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).