9-ethylcarbazole-3,6-dicarboxylic acid

C16H13NO4 — CID 3797914

IUPAC9-ethylcarbazole-3,6-dicarboxylic acid
SMILESCCn1c2ccc(C(=O)O)cc2c2cc(C(=O)O)ccc21
InChIInChI=1S/C16H13NO4/c1-2-17-13-5-3-9(15(18)19)7-11(13)12-8-10(16(20)21)4-6-14(12)17/h3-8H,2H2,1H3,(H,18,19)(H,20,21)
InChIKeyMYFXCPANJUZOOT-UHFFFAOYSA-N
MW283.28 g/mol
LogP3.21
Rot. Bonds3

About 9-ethylcarbazole-3,6-dicarboxylic acid

9-ethylcarbazole-3,6-dicarboxylic acid (PubChem CID 3797914) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 9-ethylcarbazole-3,6-dicarboxylic acid.

Molecular Properties

Compound Name9-ethylcarbazole-3,6-dicarboxylic acid
PubChem CID3797914
Molecular FormulaC16H13NO4
Molecular Weight283.28 g/mol
Exact Mass283.08
IUPAC Name9-ethylcarbazole-3,6-dicarboxylic acid
SMILESCCn1c2ccc(C(=O)O)cc2c2cc(C(=O)O)ccc21
InChIInChI=1S/C16H13NO4/c1-2-17-13-5-3-9(15(18)19)7-11(13)12-8-10(16(20)21)4-6-14(12)17/h3-8H,2H2,1H3,(H,18,19)(H,20,21)
InChIKeyMYFXCPANJUZOOT-UHFFFAOYSA-N
XLogP3.21
TPSA79.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 53.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 9-ethylcarbazole-3,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-ethylcarbazole-3,6-dicarboxylic acid?
The IUPAC name of 9-ethylcarbazole-3,6-dicarboxylic acid (CID 3797914) is 9-ethylcarbazole-3,6-dicarboxylic acid.
What is the SMILES notation for 9-ethylcarbazole-3,6-dicarboxylic acid?
The canonical SMILES for 9-ethylcarbazole-3,6-dicarboxylic acid is CCn1c2ccc(C(=O)O)cc2c2cc(C(=O)O)ccc21.
What is the InChIKey of 9-ethylcarbazole-3,6-dicarboxylic acid?
The InChIKey is MYFXCPANJUZOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-2-17-13-5-3-9(15(18)19)7-11(13)12-8-10(16(20)21)4-6-14(12)17/h3-8H,2H2,1H3,(H,18,19)(H,20,21).
What are the key properties of 9-ethylcarbazole-3,6-dicarboxylic acid?
9-ethylcarbazole-3,6-dicarboxylic acid has a molecular weight of 283.28 g/mol, XLogP of 3.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylcarbazole-3,6-dicarboxylic acid is sourced from PubChem (CID 3797914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).