C28H33N5OS — CID 3798066
N-(3,5-dimethylphenyl)-2-(5-methyl-1-phenylpyrazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide (PubChem CID 3798066) has the molecular formula C28H33N5OS and a molecular weight of 487.67 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(5-methyl-1-phenylpyrazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(5-methyl-1-phenylpyrazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 3798066 |
| Molecular Formula | C28H33N5OS |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(5-methyl-1-phenylpyrazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCC3(CCN(C(=O)c4cnn(-c5ccccc5)c4C)C3)CC2)c1 |
| InChI | InChI=1S/C28H33N5OS/c1-20-15-21(2)17-23(16-20)30-27(35)31-12-9-28(10-13-31)11-14-32(19-28)26(34)25-18-29-33(22(25)3)24-7-5-4-6-8-24/h4-8,15-18H,9-14,19H2,1-3H3,(H,30,35) |
| InChIKey | MTEITVMZNAWQFA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|