About ethyl 2-imidazol-1-ylacetate
ethyl 2-imidazol-1-ylacetate (PubChem CID 3798501) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is ethyl 2-imidazol-1-ylacetate.
Molecular Properties
| Compound Name | ethyl 2-imidazol-1-ylacetate |
| PubChem CID | 3798501 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | ethyl 2-imidazol-1-ylacetate |
| SMILES | CCOC(=O)Cn1ccnc1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-11-7(10)5-9-4-3-8-6-9/h3-4,6H,2,5H2,1H3 |
| InChIKey | OITZNDMCFHYWLX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-imidazol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-imidazol-1-ylacetate?
The IUPAC name of ethyl 2-imidazol-1-ylacetate (CID 3798501) is ethyl 2-imidazol-1-ylacetate.
What is the SMILES notation for ethyl 2-imidazol-1-ylacetate?
The canonical SMILES for ethyl 2-imidazol-1-ylacetate is CCOC(=O)Cn1ccnc1.
What is the InChIKey of ethyl 2-imidazol-1-ylacetate?
The InChIKey is OITZNDMCFHYWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-2-11-7(10)5-9-4-3-8-6-9/h3-4,6H,2,5H2,1H3.
What are the key properties of ethyl 2-imidazol-1-ylacetate?
ethyl 2-imidazol-1-ylacetate has a molecular weight of 154.17 g/mol, XLogP of 0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-imidazol-1-ylacetate is sourced from PubChem (CID 3798501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).