About 1-octylsulfonyloctane
1-octylsulfonyloctane (PubChem CID 3798558) has the molecular formula C16H34O2S
and a molecular weight of 290.51 g/mol. Its IUPAC name is 1-octylsulfonyloctane.
Molecular Properties
| Compound Name | 1-octylsulfonyloctane |
| PubChem CID | 3798558 |
| Molecular Formula | C16H34O2S |
| Molecular Weight | 290.51 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | 1-octylsulfonyloctane |
| SMILES | CCCCCCCCS(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C16H34O2S/c1-3-5-7-9-11-13-15-19(17,18)16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| InChIKey | TZPCGEVFZZYCIY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octylsulfonyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylsulfonyloctane?
The IUPAC name of 1-octylsulfonyloctane (CID 3798558) is 1-octylsulfonyloctane.
What is the SMILES notation for 1-octylsulfonyloctane?
The canonical SMILES for 1-octylsulfonyloctane is CCCCCCCCS(=O)(=O)CCCCCCCC.
What is the InChIKey of 1-octylsulfonyloctane?
The InChIKey is TZPCGEVFZZYCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2S/c1-3-5-7-9-11-13-15-19(17,18)16-14-12-10-8-6-4-2/h3-16H2,1-2H3.
What are the key properties of 1-octylsulfonyloctane?
1-octylsulfonyloctane has a molecular weight of 290.51 g/mol, XLogP of 5.12, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylsulfonyloctane is sourced from PubChem (CID 3798558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).