About 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one
4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one (PubChem CID 3798772) has the molecular formula C7H10O3S4
and a molecular weight of 270.42 g/mol. Its IUPAC name is 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one.
Molecular Properties
| Compound Name | 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one |
| PubChem CID | 3798772 |
| Molecular Formula | C7H10O3S4 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one |
| SMILES | O=c1sc(SCCO)c(SCCO)s1 |
| InChI | InChI=1S/C7H10O3S4/c8-1-3-11-5-6(12-4-2-9)14-7(10)13-5/h8-9H,1-4H2 |
| InChIKey | XQAWOBOYIWEOTD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one?
The IUPAC name of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one (CID 3798772) is 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one.
What is the SMILES notation for 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one?
The canonical SMILES for 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one is O=c1sc(SCCO)c(SCCO)s1.
What is the InChIKey of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one?
The InChIKey is XQAWOBOYIWEOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S4/c8-1-3-11-5-6(12-4-2-9)14-7(10)13-5/h8-9H,1-4H2.
What are the key properties of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one?
4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one has a molecular weight of 270.42 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiol-2-one is sourced from PubChem (CID 3798772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).