About [2-(2,6-dichlorophenoxy)ethylamino]azanium
[2-(2,6-dichlorophenoxy)ethylamino]azanium (PubChem CID 3798877) has the molecular formula C8H11Cl2N2O+
and a molecular weight of 222.09 g/mol. Its IUPAC name is [2-(2,6-dichlorophenoxy)ethylamino]azanium.
Molecular Properties
| Compound Name | [2-(2,6-dichlorophenoxy)ethylamino]azanium |
| PubChem CID | 3798877 |
| Molecular Formula | C8H11Cl2N2O+ |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | [2-(2,6-dichlorophenoxy)ethylamino]azanium |
| SMILES | [NH3+]NCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O/c9-6-2-1-3-7(10)8(6)13-5-4-12-11/h1-3,12H,4-5,11H2/p+1 |
| InChIKey | ISFRQPYFMIVDTO-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 48.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,6-dichlorophenoxy)ethylamino]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dichlorophenoxy)ethylamino]azanium?
The IUPAC name of [2-(2,6-dichlorophenoxy)ethylamino]azanium (CID 3798877) is [2-(2,6-dichlorophenoxy)ethylamino]azanium.
What is the SMILES notation for [2-(2,6-dichlorophenoxy)ethylamino]azanium?
The canonical SMILES for [2-(2,6-dichlorophenoxy)ethylamino]azanium is [NH3+]NCCOc1c(Cl)cccc1Cl.
What is the InChIKey of [2-(2,6-dichlorophenoxy)ethylamino]azanium?
The InChIKey is ISFRQPYFMIVDTO-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H10Cl2N2O/c9-6-2-1-3-7(10)8(6)13-5-4-12-11/h1-3,12H,4-5,11H2/p+1.
What are the key properties of [2-(2,6-dichlorophenoxy)ethylamino]azanium?
[2-(2,6-dichlorophenoxy)ethylamino]azanium has a molecular weight of 222.09 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dichlorophenoxy)ethylamino]azanium is sourced from PubChem (CID 3798877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).