C18H28O10S — CID 3799111
diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-1,1-dioxothiolan-3-yl]propanedioate (PubChem CID 3799111) has the molecular formula C18H28O10S and a molecular weight of 436.48 g/mol. Its IUPAC name is diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-1,1-dioxothiolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-1,1-dioxothiolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 3799111 |
| Molecular Formula | C18H28O10S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | diethyl 2-[4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-1,1-dioxothiolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1CS(=O)(=O)CC1C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H28O10S/c1-5-25-15(19)13(16(20)26-6-2)11-9-29(23,24)10-12(11)14(17(21)27-7-3)18(22)28-8-4/h11-14H,5-10H2,1-4H3 |
| InChIKey | HVAYKSQZICOOFW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|