About 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one
1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 3799752) has the molecular formula C20H19N3O4S
and a molecular weight of 397.46 g/mol. Its IUPAC name is 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| PubChem CID | 3799752 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | COc1ccc(OC)c(/N=C/c2c(O)n(Cc3ccccc3)c(=S)[nH]c2=O)c1 |
| InChI | InChI=1S/C20H19N3O4S/c1-26-14-8-9-17(27-2)16(10-14)21-11-15-18(24)22-20(28)23(19(15)25)12-13-6-4-3-5-7-13/h3-11,25H,12H2,1-2H3,(H,22,24,28)/b21-11+ |
| InChIKey | WBNFOSJNBJRYOE-SRZZPIQSSA-N |
| XLogP | 3.43 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
The IUPAC name of 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one (CID 3799752) is 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
What is the SMILES notation for 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
The canonical SMILES for 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one is COc1ccc(OC)c(/N=C/c2c(O)n(Cc3ccccc3)c(=S)[nH]c2=O)c1.
What is the InChIKey of 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
The InChIKey is WBNFOSJNBJRYOE-SRZZPIQSSA-N. The full InChI is InChI=1S/C20H19N3O4S/c1-26-14-8-9-17(27-2)16(10-14)21-11-15-18(24)22-20(28)23(19(15)25)12-13-6-4-3-5-7-13/h3-11,25H,12H2,1-2H3,(H,22,24,28)/b21-11+.
What are the key properties of 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one?
1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one has a molecular weight of 397.46 g/mol, XLogP of 3.43, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-[(2,5-dimethoxyphenyl)iminomethyl]-6-hydroxy-2-sulfanylidenepyrimidin-4-one is sourced from PubChem (CID 3799752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).