C12H18ClNO4S3 — CID 3799769
propan-2-yl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 3799769) has the molecular formula C12H18ClNO4S3 and a molecular weight of 371.93 g/mol. Its IUPAC name is propan-2-yl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3799769 |
| Molecular Formula | C12H18ClNO4S3 |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | propan-2-yl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)s1)C(=O)OC(C)C |
| InChI | InChI=1S/C12H18ClNO4S3/c1-8(2)18-12(15)9(6-7-19-3)14-21(16,17)11-5-4-10(13)20-11/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChIKey | IJXMBCKNBGVTFL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |