About 4-oxohexanoic acid
4-oxohexanoic acid (PubChem CID 3799774) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 4-oxohexanoic acid.
Molecular Properties
| Compound Name | 4-oxohexanoic acid |
| PubChem CID | 3799774 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4-oxohexanoic acid |
| SMILES | CCC(=O)CCC(=O)O |
| InChI | InChI=1S/C6H10O3/c1-2-5(7)3-4-6(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | CLJBDOUIEHLLEN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohexanoic acid?
The IUPAC name of 4-oxohexanoic acid (CID 3799774) is 4-oxohexanoic acid.
What is the SMILES notation for 4-oxohexanoic acid?
The canonical SMILES for 4-oxohexanoic acid is CCC(=O)CCC(=O)O.
What is the InChIKey of 4-oxohexanoic acid?
The InChIKey is CLJBDOUIEHLLEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-2-5(7)3-4-6(8)9/h2-4H2,1H3,(H,8,9).
What are the key properties of 4-oxohexanoic acid?
4-oxohexanoic acid has a molecular weight of 130.14 g/mol, XLogP of 0.83, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohexanoic acid is sourced from PubChem (CID 3799774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).